![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1. User Manual_Versi..> | 2022-02-27 18:55 | 32M | |
| 1. WBIDC.pdf | 2022-08-26 09:07 | 2.5M | |
| 2. User Manual_Versi..> | 2022-05-16 13:16 | 35M | |
| 2. WBIIDC.pdf | 2022-08-26 09:08 | 4.1M | |
| 3. WBSIDCL.pdf | 2022-08-26 09:09 | 255K | |
| 4. WBEIDCL.pdf | 2022-08-26 09:12 | 2.5M | |
| 89-UDMA-Gazette noti..> | 2024-02-23 13:39 | 205K | |
| 112_ma.pdf | 2023-02-08 13:57 | 228K | |
| 161_MA_O_C_4_1M_31_2..> | 2021-02-04 11:10 | 760K | |
| 172_udma_11022022.pdf | 2022-04-01 09:18 | 2.7M | |
| 173_udma_11022022.pdf | 2022-04-01 09:18 | 1.1M | |
| 208_ma_2019.pdf | 2023-08-31 10:40 | 240K | |
| 227 dt. 9.4.10.pdf | 2023-08-31 11:00 | 178K | |
| 272 dt.13.4.18.pdf | 2023-08-31 10:40 | 102K | |
| 273 dt.13.4.18.pdf | 2023-08-31 10:41 | 104K | |
| 386_ma1.pdf | 2022-07-19 18:13 | 203K | |
| 446 dt. 22.6.18.pdf | 2023-08-31 10:41 | 632K | |
| 479 dt.10.9.07.pdf | 2023-08-31 10:42 | 391K | |
| 548-ma_2015-2016.pdf | 2023-08-23 17:18 | 248K | |
| 555-MA-WBM(Bld) Rule..> | 2024-03-01 09:57 | 433K | |
| 571 dt. 29.8.17.pdf | 2023-08-31 10:42 | 586K | |
| 611_ma.pdf | 2022-06-28 08:36 | 224K | |
| 665_udma.pdf | 2022-06-29 16:25 | 322K | |
| 696-MA.pdf | 2023-09-14 17:57 | 128K | |
| 773 dt. 1.12.15.pdf | 2023-08-31 10:43 | 282K | |
| 870_ma_hmc.pdf | 2022-09-29 10:16 | 362K | |
| 876-UDMA - relaxatio..> | 2022-09-29 10:16 | 636K | |
| 889-UDMA-Minor Devia..> | 2023-12-04 17:48 | 338K | |
| 976_ma_02082021.pdf | 2022-04-01 09:18 | 379K | |
| 1028_ma.pdf | 2022-10-25 20:04 | 148K | |
| 1106_MA.pdf | 2022-12-04 20:45 | 954K | |
| 1180_ma_2015.pdf | 2024-01-29 18:16 | 849K | |
| 1395_ma.pdf | 2022-04-01 09:18 | 385K | |
| Amendment Notificati..> | 2021-02-04 11:53 | 152K | |
| Amendment_of_WB Muni..> | 2021-02-04 11:20 | 3.6M | |
| Amendment_of_WB Muni..> | 2021-02-04 11:38 | 3.6M | |
| Building Plan Checkl..> | 2021-02-04 11:23 | 508K | |
| Checklist for Lift I..> | 2021-08-17 12:56 | 258K | |
| Checklist for Lift I..> | 2021-07-27 17:39 | 28K | |
| Checklist of Sub-As..> | 2022-08-27 16:18 | 32K | |
| Commercial_Sample_DW..> | 2018-05-25 18:42 | 165K | |
| Commercial_Sample_DW..> | 2018-05-25 18:42 | 1.2M | |
| Digital Certificate ..> | 2021-11-06 15:18 | 541K | |
| FORM-A-LIFT-ESCALATO..> | 2021-07-27 17:39 | 32K | |
| Fees Structure.pdf | 2021-02-04 11:35 | 254K | |
| Green Building .pdf | 2023-08-31 10:43 | 2.6M | |
| NOTIFICATION_ON_BUIL..> | 2022-06-16 12:03 | 2.5M | |
| New_Fees Structure_R..> | 2021-02-26 16:23 | 411K | |
| Notification -SWS-OB..> | 2022-06-16 12:03 | 777K | |
| Notification_339MA_0..> | 2023-05-15 09:36 | 1.2M | |
| Notification of Sanc..> | 2022-06-24 12:22 | 539K | |
| Notification on OBPA..> | 2022-09-27 14:58 | 1.1M | |
| PMBBL-2018.pdf | 2019-02-13 10:14 | 1.5M | |
| PMBBL-2020.pdf | 2020-10-15 11:04 | 200K | |
| Precheck Errors & Co..> | 2022-09-05 13:33 | 40M | |
| Precheck Errors & Co..> | 2021-08-16 14:35 | 24M | |
| Precheck Errors & Co..> | 2021-07-01 11:13 | 17M | |
| Precheck Errors & Co..> | 2021-09-15 16:30 | 26M | |
| Precheck Errors & Co..> | 2021-12-14 10:32 | 40M | |
| SAE Report for Issua..> | 2022-08-27 15:19 | 32K | |
| SAE Report for Issua..> | 2022-08-27 15:19 | 32K | |
| The WB Municipal _Bu..> | 2021-01-22 17:36 | 1.1M | |
| ULB_AdminProcess_V2...> | 2021-08-16 10:17 | 2.2M | |
| ULB_Citizen_V1.pdf | 2021-08-18 17:12 | 2.1M | |
| ULB_Consultant_V2.pdf | 2021-08-18 17:13 | 1.6M | |
| User Guide Nocas.pdf | 2021-07-28 15:35 | 2.1M | |
| User Manual - Citize..> | 2021-06-30 10:29 | 3.2M | |
| User Manual - Consul..> | 2021-06-30 10:29 | 4.1M | |
| User Manual - Nodal ..> | 2021-06-30 10:29 | 1.9M | |
| User Manual - Signat..> | 2021-06-30 10:29 | 1.5M | |
| User Manual - Super-..> | 2021-06-30 10:30 | 3.0M | |
| User Manual - ULB (E..> | 2021-06-30 10:30 | 2.6M | |
| User Manual - ULB Ad..> | 2021-06-30 10:30 | 1.2M | |
| UserManual.pdf | 2021-07-28 15:38 | 3.3M | |
| User Manual_Version ..> | 2021-08-16 14:38 | 25M | |
| User Manual_Version ..> | 2022-06-24 12:28 | 51M | |
| User Manual_Version ..> | 2022-08-02 08:51 | 46M | |
| User Manual_Version ..> | 2021-08-26 12:14 | 27M | |
| User Manual_Version ..> | 2021-07-01 11:14 | 38M | |
| User Manual_Version ..> | 2022-08-31 15:36 | 22M | |
| User Manual_Version ..> | 2022-05-16 13:14 | 22M | |
| User Manual_Version ..> | 2021-09-15 16:29 | 27M | |
| User Manual_Version ..> | 2021-11-02 08:32 | 30M | |
| User Manual_Version ..> | 2022-09-14 12:44 | 54M | |
| User Manual_Version ..> | 2022-09-14 12:29 | 39M | |
| User Manual_Version ..> | 2023-08-01 17:34 | 23M | |
| User Manual_Version ..> | 2023-08-01 17:39 | 22M | |
| User Manual_Version ..> | 2023-08-01 17:40 | 26M | |
| User Manual_Version ..> | 2022-12-10 20:20 | 30M | |
| User Manual_Version ..> | 2022-12-10 20:45 | 30M | |
| User Manual_Version ..> | 2024-03-27 18:47 | 28M | |
| User Manual_Version ..> | 2024-03-26 08:18 | 26M | |
| User Manual_Version ..> | 2024-03-26 08:19 | 28M | |
| User Manual_Version ..> | 2022-12-10 20:27 | 28M | |
| User Manual_Version ..> | 2023-08-01 17:38 | 21M | |
| User Manual_Version ..> | 2023-08-01 17:36 | 21M | |
| User Manual_Version ..> | 2023-08-01 16:40 | 20M | |
| User Manual_Version ..> | 2024-03-26 08:19 | 26M | |
| User_Manual_1.0.pdf | 2021-01-22 17:06 | 8.3M | |
| User_Manual_ULC.pdf | 2021-07-28 15:38 | 285K | |
| Video.php | 2021-07-03 15:26 | 287 | |
| Video.php_Backup | 2021-06-30 10:49 | 221 | |
| WBEIDC_Applicant_V.1..> | 2022-06-27 17:44 | 1.5M | |
| WBEIDC_Consultant_V...> | 2022-06-27 17:41 | 1.3M | |
| WBIDC_Applicant_V.1.pdf | 2022-09-27 15:21 | 1.6M | |
| WBIDC_Consultant_V.1..> | 2022-09-27 15:24 | 1.3M | |
| WBIIDC_Applicant_V.1..> | 2022-09-27 15:28 | 1.6M | |
| WBIIDC_Consultant_V...> | 2022-09-27 15:31 | 1.3M | |
| WB Municipal Buildin..> | 2021-02-04 10:54 | 1.1M | |
| WBSIDCL_Notification..> | 2022-08-02 10:00 | 740K | |
| WBSIDC_Applicant_V 1..> | 2022-08-02 08:55 | 574K | |
| WBSIDC_Consultant_V ..> | 2022-08-02 08:58 | 688K | |
| WB_Content_V2.pdf | 2021-02-07 19:44 | 56K | |
| WBeDistrict_Building..> | 2021-07-27 17:46 | 7.2K | |
| WBeDistrict_Certifie..> | 2021-07-27 16:40 | 7.5K | |
| WBeDistrict_Issuance..> | 2021-07-27 16:40 | 6.5K | |
| WBeDistrict_Issuance..> | 2021-07-27 17:47 | 6.4K | |
| clu.pdf | 2020-12-23 12:42 | 202K | |
| clu2.pdf | 2020-12-23 12:43 | 202K | |
| combined_affidavits_..> | 2021-02-04 11:23 | 139K | |
| config.inc.php | 2022-08-27 15:19 | 350 | |
| drawings/ | 2019-02-26 10:05 | - | |
| guideline_booklet_fo..> | 2021-07-28 15:15 | 16M | |
| header1_idcs.php | 2022-09-27 14:59 | 24K | |
| letter to CEO.pdf | 2022-08-03 12:42 | 346K | |
| purposed_buildin_pla..> | 2020-12-23 12:43 | 139K | |
| style.css | 2020-06-04 14:10 | 878 | |